| Name | Triethanolamine hydrochloride |
| Synonyms | TRIETHANOLAMINE HCL triethanolamine hcl TRIETHANOLAMINE HYDROCHLORIDE TRIETHYLOLAMINE HYDROCHLORIDE Triethanolamine hydrochloride TRIHYDROXYTRIETHYLAMINE HYDROCHLORIDE tris(2-hydroxyethyl)ammonium chloride 2,2',2'-NITRILITRIETHANOL HYDROCHLORIDE 2,2',2''-nitrilotri-ethanohydrochloride 2,2',2''-NITRILOTRIETHANOL HYDROCHLORIDE 2,2',2''-nitrilotris-ethanohydrochloride 2,2,2-Nitrilotriethanol hydrochloride~Tris(2-hydroxyethyl)amine hydrochloride |
| CAS | 637-39-8 |
| EINECS | 211-284-2 |
| InChI | InChI=1/C6H15NO3.ClH/c8-4-1-7(2-5-9)3-6-10;/h8-10H,1-6H2;1H |
| InChIKey | HHLJUSLZGFYWKW-UHFFFAOYSA-N |
| Molecular Formula | C6H16ClNO3 |
| Molar Mass | 185.65 |
| Density | 1.354[at 20℃] |
| Melting Point | 177-179°C(lit.) |
| Boling Point | 335.4°C at 760 mmHg |
| Flash Point | 185°C |
| Water Solubility | Soluble in water. |
| Solubility | H2O: 1M at20°C, clear, colorless |
| Vapor Presure | 0Pa at 20℃ |
| Appearance | Solid |
| Color | White crystalline |
| Odor | Amine like |
| Merck | 14,9665 |
| BRN | 3909940 |
| pKa | 7.8(at 25℃) |
| Storage Condition | Store at RT. |
| Sensitive | Hygroscopic |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 1 |
| RTECS | KL9346500 |
| FLUKA BRAND F CODES | 3 |
| TSCA | Yes |
| HS Code | 29221320 |
| pH range of acid-base indicator discoloration | 7.3 - 8.3 |
| LogP | -3.697 at 20℃ |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | measures tin and antimony. Softening agent. Synthetic resin. |